C16H14N4O — CID 43449875
4-[(7-amino-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]benzonitrile (PubChem CID 43449875) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is 4-[(7-amino-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]benzonitrile.
| Compound Name | 4-[(7-amino-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 43449875 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-[(7-amino-2-oxo-3,4-dihydro-1H-quinolin-6-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2cc3c(cc2N)NC(=O)CC3)cc1 |
| InChI | InChI=1S/C16H14N4O/c17-9-10-1-4-12(5-2-10)19-15-7-11-3-6-16(21)20-14(11)8-13(15)18/h1-2,4-5,7-8,19H,3,6,18H2,(H,20,21) |
| InChIKey | GPDDRJORHJVPCW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|