C16H13N3O2 — CID 43449983
3-[(7-amino-2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]benzonitrile (PubChem CID 43449983) has the molecular formula C16H13N3O2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-[(7-amino-2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]benzonitrile.
| Compound Name | 3-[(7-amino-2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]benzonitrile |
|---|---|
| PubChem CID | 43449983 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-[(7-amino-2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]benzonitrile |
| SMILES | N#Cc1cccc(Oc2cc3c(cc2N)NC(=O)CC3)c1 |
| InChI | InChI=1S/C16H13N3O2/c17-9-10-2-1-3-12(6-10)21-15-7-11-4-5-16(20)19-14(11)8-13(15)18/h1-3,6-8H,4-5,18H2,(H,19,20) |
| InChIKey | FCBCQGIDYNQGKW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|