C16H16N2O2S — CID 63649793
6-amino-7-(4-methylsulfanylphenoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 63649793) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 6-amino-7-(4-methylsulfanylphenoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-7-(4-methylsulfanylphenoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 63649793 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 6-amino-7-(4-methylsulfanylphenoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CSc1ccc(Oc2cc3c(cc2N)CCC(=O)N3)cc1 |
| InChI | InChI=1S/C16H16N2O2S/c1-21-12-5-3-11(4-6-12)20-15-9-14-10(8-13(15)17)2-7-16(19)18-14/h3-6,8-9H,2,7,17H2,1H3,(H,18,19) |
| InChIKey | FFEDDJNDRNCFEK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|