C14H11IN2O2 — CID 43451950
5-amino-6-(4-iodophenoxy)-1,3-dihydroindol-2-one (PubChem CID 43451950) has the molecular formula C14H11IN2O2 and a molecular weight of 366.16 g/mol. Its IUPAC name is 5-amino-6-(4-iodophenoxy)-1,3-dihydroindol-2-one.
| Compound Name | 5-amino-6-(4-iodophenoxy)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43451950 |
| Molecular Formula | C14H11IN2O2 |
| Molecular Weight | 366.16 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 5-amino-6-(4-iodophenoxy)-1,3-dihydroindol-2-one |
| SMILES | Nc1cc2c(cc1Oc1ccc(I)cc1)NC(=O)C2 |
| InChI | InChI=1S/C14H11IN2O2/c15-9-1-3-10(4-2-9)19-13-7-12-8(5-11(13)16)6-14(18)17-12/h1-5,7H,6,16H2,(H,17,18) |
| InChIKey | VUQCQELAOLYWQR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.16 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|