C15H12F2N2O2 — CID 43455648
6-amino-7-(2,4-difluorophenoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43455648) has the molecular formula C15H12F2N2O2 and a molecular weight of 290.27 g/mol. Its IUPAC name is 6-amino-7-(2,4-difluorophenoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-7-(2,4-difluorophenoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43455648 |
| Molecular Formula | C15H12F2N2O2 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 6-amino-7-(2,4-difluorophenoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1cc2c(cc1Oc1ccc(F)cc1F)NC(=O)CC2 |
| InChI | InChI=1S/C15H12F2N2O2/c16-9-2-3-13(10(17)6-9)21-14-7-12-8(5-11(14)18)1-4-15(20)19-12/h2-3,5-7H,1,4,18H2,(H,19,20) |
| InChIKey | RWAZBNXEBLSVAI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|