C14H10F2N2O3 — CID 63268729
7-amino-6-(2,5-difluorophenoxy)-4H-1,4-benzoxazin-3-one (PubChem CID 63268729) has the molecular formula C14H10F2N2O3 and a molecular weight of 292.24 g/mol. Its IUPAC name is 7-amino-6-(2,5-difluorophenoxy)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(2,5-difluorophenoxy)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 63268729 |
| Molecular Formula | C14H10F2N2O3 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 7-amino-6-(2,5-difluorophenoxy)-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cc2c(cc1Oc1cc(F)ccc1F)NC(=O)CO2 |
| InChI | InChI=1S/C14H10F2N2O3/c15-7-1-2-8(16)11(3-7)21-12-5-10-13(4-9(12)17)20-6-14(19)18-10/h1-5H,6,17H2,(H,18,19) |
| InChIKey | LXZMTBBUJHPMCM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|