C15H14N2O4 — CID 61228361
7-amino-6-[4-(hydroxymethyl)phenoxy]-4H-1,4-benzoxazin-3-one (PubChem CID 61228361) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 7-amino-6-[4-(hydroxymethyl)phenoxy]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-[4-(hydroxymethyl)phenoxy]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 61228361 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 7-amino-6-[4-(hydroxymethyl)phenoxy]-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cc2c(cc1Oc1ccc(CO)cc1)NC(=O)CO2 |
| InChI | InChI=1S/C15H14N2O4/c16-11-5-14-12(17-15(19)8-20-14)6-13(11)21-10-3-1-9(7-18)2-4-10/h1-6,18H,7-8,16H2,(H,17,19) |
| InChIKey | NRQQFSXCVOIVST-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|