C9H10N2O2 — CID 16765287
6-amino-7-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 16765287) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 6-amino-7-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-7-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 16765287 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 6-amino-7-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cc2c(cc1N)NC(=O)CO2 |
| InChI | InChI=1S/C9H10N2O2/c1-5-2-8-7(3-6(5)10)11-9(12)4-13-8/h2-3H,4,10H2,1H3,(H,11,12) |
| InChIKey | YETQJBKKHIFDQY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|