C9H11N3O4S — CID 43550407
N-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)methanesulfonamide (PubChem CID 43550407) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is N-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)methanesulfonamide.
| Compound Name | N-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)methanesulfonamide |
|---|---|
| PubChem CID | 43550407 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc2c(cc1N)OCC(=O)N2 |
| InChI | InChI=1S/C9H11N3O4S/c1-17(14,15)12-6-3-7-8(2-5(6)10)16-4-9(13)11-7/h2-3,12H,4,10H2,1H3,(H,11,13) |
| InChIKey | CSZQHXGKQJNQMC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|