C11H14N4O3 — CID 43479338
2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]-N-methylacetamide (PubChem CID 43479338) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]-N-methylacetamide.
| Compound Name | 2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]-N-methylacetamide |
|---|---|
| PubChem CID | 43479338 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]-N-methylacetamide |
| SMILES | CNC(=O)CNc1cc2c(cc1N)OCC(=O)N2 |
| InChI | InChI=1S/C11H14N4O3/c1-13-10(16)4-14-7-3-8-9(2-6(7)12)18-5-11(17)15-8/h2-3,14H,4-5,12H2,1H3,(H,13,16)(H,15,17) |
| InChIKey | WSLGYRIPCMZRAP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|