C12H16N4O2 — CID 43383610
2-[(6-amino-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]-N-methylacetamide (PubChem CID 43383610) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 2-[(6-amino-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]-N-methylacetamide.
| Compound Name | 2-[(6-amino-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]-N-methylacetamide |
|---|---|
| PubChem CID | 43383610 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-[(6-amino-2-oxo-3,4-dihydro-1H-quinolin-7-yl)amino]-N-methylacetamide |
| SMILES | CNC(=O)CNc1cc2c(cc1N)CCC(=O)N2 |
| InChI | InChI=1S/C12H16N4O2/c1-14-12(18)6-15-10-5-9-7(4-8(10)13)2-3-11(17)16-9/h4-5,15H,2-3,6,13H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | NEGXANQFFQXOMP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|