C13H19N3O2 — CID 65034025
7-amino-6-[(3-hydroxy-2-methylpropyl)amino]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 65034025) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 7-amino-6-[(3-hydroxy-2-methylpropyl)amino]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-amino-6-[(3-hydroxy-2-methylpropyl)amino]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 65034025 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 7-amino-6-[(3-hydroxy-2-methylpropyl)amino]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CC(CO)CNc1cc2c(cc1N)NC(=O)CC2 |
| InChI | InChI=1S/C13H19N3O2/c1-8(7-17)6-15-12-4-9-2-3-13(18)16-11(9)5-10(12)14/h4-5,8,15,17H,2-3,6-7,14H2,1H3,(H,16,18) |
| InChIKey | JJKDREUNOKIVDA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|