C11H15N3O — CID 43455516
6-amino-7-(ethylamino)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 43455516) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-amino-7-(ethylamino)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-7-(ethylamino)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 43455516 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 6-amino-7-(ethylamino)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCNc1cc2c(cc1N)CCC(=O)N2 |
| InChI | InChI=1S/C11H15N3O/c1-2-13-10-6-9-7(5-8(10)12)3-4-11(15)14-9/h5-6,13H,2-4,12H2,1H3,(H,14,15) |
| InChIKey | BPGQIBOAJOVMCP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|