C13H19N3O4S — CID 79561041
7-amino-6-[(2-methyl-2-methylsulfonylpropyl)amino]-4H-1,4-benzoxazin-3-one (PubChem CID 79561041) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is 7-amino-6-[(2-methyl-2-methylsulfonylpropyl)amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-[(2-methyl-2-methylsulfonylpropyl)amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 79561041 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 7-amino-6-[(2-methyl-2-methylsulfonylpropyl)amino]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C)(CNc1cc2c(cc1N)OCC(=O)N2)S(C)(=O)=O |
| InChI | InChI=1S/C13H19N3O4S/c1-13(2,21(3,18)19)7-15-9-5-10-11(4-8(9)14)20-6-12(17)16-10/h4-5,15H,6-7,14H2,1-3H3,(H,16,17) |
| InChIKey | GNIKLFXVPDTYHW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|