C13H15N5O2 — CID 82882719
7-amino-6-[(1-methylpyrazol-3-yl)methylamino]-4H-1,4-benzoxazin-3-one (PubChem CID 82882719) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is 7-amino-6-[(1-methylpyrazol-3-yl)methylamino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-[(1-methylpyrazol-3-yl)methylamino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82882719 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 7-amino-6-[(1-methylpyrazol-3-yl)methylamino]-4H-1,4-benzoxazin-3-one |
| SMILES | Cn1ccc(CNc2cc3c(cc2N)OCC(=O)N3)n1 |
| InChI | InChI=1S/C13H15N5O2/c1-18-3-2-8(17-18)6-15-10-5-11-12(4-9(10)14)20-7-13(19)16-11/h2-5,15H,6-7,14H2,1H3,(H,16,19) |
| InChIKey | VKUDFYFVFGDGQG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|