C10H13N3O2 — CID 43479176
7-amino-6-(ethylamino)-4H-1,4-benzoxazin-3-one (PubChem CID 43479176) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 7-amino-6-(ethylamino)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(ethylamino)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43479176 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 7-amino-6-(ethylamino)-4H-1,4-benzoxazin-3-one |
| SMILES | CCNc1cc2c(cc1N)OCC(=O)N2 |
| InChI | InChI=1S/C10H13N3O2/c1-2-12-7-4-8-9(3-6(7)11)15-5-10(14)13-8/h3-4,12H,2,5,11H2,1H3,(H,13,14) |
| InChIKey | ANLDSFUIWIGQIY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|