C13H19N3O3 — CID 107316519
7-amino-6-(5-hydroxypentylamino)-4H-1,4-benzoxazin-3-one (PubChem CID 107316519) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 7-amino-6-(5-hydroxypentylamino)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(5-hydroxypentylamino)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 107316519 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 7-amino-6-(5-hydroxypentylamino)-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cc2c(cc1NCCCCCO)NC(=O)CO2 |
| InChI | InChI=1S/C13H19N3O3/c14-9-6-12-11(16-13(18)8-19-12)7-10(9)15-4-2-1-3-5-17/h6-7,15,17H,1-5,8,14H2,(H,16,18) |
| InChIKey | YRNDLDZRESCMFK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|