C13H18N4O3 — CID 106234227
5-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]pentanamide (PubChem CID 106234227) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]pentanamide.
| Compound Name | 5-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]pentanamide |
|---|---|
| PubChem CID | 106234227 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]pentanamide |
| SMILES | NC(=O)CCCCNc1cc2c(cc1N)OCC(=O)N2 |
| InChI | InChI=1S/C13H18N4O3/c14-8-5-11-10(17-13(19)7-20-11)6-9(8)16-4-2-1-3-12(15)18/h5-6,16H,1-4,7,14H2,(H2,15,18)(H,17,19) |
| InChIKey | HFPYKLUGDOZHHJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|