C13H18N4O3 — CID 106344012
2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]-3-methylbutanamide (PubChem CID 106344012) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]-3-methylbutanamide.
| Compound Name | 2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106344012 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-[(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)amino]-3-methylbutanamide |
| SMILES | CC(C)C(Nc1cc2c(cc1N)OCC(=O)N2)C(N)=O |
| InChI | InChI=1S/C13H18N4O3/c1-6(2)12(13(15)19)17-8-4-9-10(3-7(8)14)20-5-11(18)16-9/h3-4,6,12,17H,5,14H2,1-2H3,(H2,15,19)(H,16,18) |
| InChIKey | UVDAPBJBJXHPIW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|