C11H13N3O4 — CID 43551157
ethyl N-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)carbamate (PubChem CID 43551157) has the molecular formula C11H13N3O4 and a molecular weight of 251.24 g/mol. Its IUPAC name is ethyl N-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)carbamate.
| Compound Name | ethyl N-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)carbamate |
|---|---|
| PubChem CID | 43551157 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | ethyl N-(7-amino-3-oxo-4H-1,4-benzoxazin-6-yl)carbamate |
| SMILES | CCOC(=O)Nc1cc2c(cc1N)OCC(=O)N2 |
| InChI | InChI=1S/C11H13N3O4/c1-2-17-11(16)14-7-4-8-9(3-6(7)12)18-5-10(15)13-8/h3-4H,2,5,12H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | ZNACJLGNEJHDBN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|