C11H13N3O5 — CID 43479255
6-(3-hydroxypropylamino)-7-nitro-4H-1,4-benzoxazin-3-one (PubChem CID 43479255) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is 6-(3-hydroxypropylamino)-7-nitro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(3-hydroxypropylamino)-7-nitro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43479255 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 6-(3-hydroxypropylamino)-7-nitro-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc([N+](=O)[O-])c(NCCCO)cc2N1 |
| InChI | InChI=1S/C11H13N3O5/c15-3-1-2-12-7-4-8-10(5-9(7)14(17)18)19-6-11(16)13-8/h4-5,12,15H,1-3,6H2,(H,13,16) |
| InChIKey | WZZRMUDCPGDQMV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|