C16H14FN3O4 — CID 78878660
6-[2-(4-fluorophenyl)ethylamino]-7-nitro-4H-1,4-benzoxazin-3-one (PubChem CID 78878660) has the molecular formula C16H14FN3O4 and a molecular weight of 331.30 g/mol. Its IUPAC name is 6-[2-(4-fluorophenyl)ethylamino]-7-nitro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(4-fluorophenyl)ethylamino]-7-nitro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 78878660 |
| Molecular Formula | C16H14FN3O4 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 6-[2-(4-fluorophenyl)ethylamino]-7-nitro-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc([N+](=O)[O-])c(NCCc3ccc(F)cc3)cc2N1 |
| InChI | InChI=1S/C16H14FN3O4/c17-11-3-1-10(2-4-11)5-6-18-12-7-13-15(8-14(12)20(22)23)24-9-16(21)19-13/h1-4,7-8,18H,5-6,9H2,(H,19,21) |
| InChIKey | OXZDHLVQIIAARI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|