C9H5N3O4 — CID 169171369
7-nitro-3-oxo-4H-1,4-benzoxazine-6-carbonitrile (PubChem CID 169171369) has the molecular formula C9H5N3O4 and a molecular weight of 219.16 g/mol. Its IUPAC name is 7-nitro-3-oxo-4H-1,4-benzoxazine-6-carbonitrile.
| Compound Name | 7-nitro-3-oxo-4H-1,4-benzoxazine-6-carbonitrile |
|---|---|
| PubChem CID | 169171369 |
| Molecular Formula | C9H5N3O4 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 7-nitro-3-oxo-4H-1,4-benzoxazine-6-carbonitrile |
| SMILES | N#Cc1cc2c(cc1[N+](=O)[O-])OCC(=O)N2 |
| InChI | InChI=1S/C9H5N3O4/c10-3-5-1-6-8(2-7(5)12(14)15)16-4-9(13)11-6/h1-2H,4H2,(H,11,13) |
| InChIKey | ZIBMKRWWWCLZTM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|