C11H14N4O4 — CID 62687384
6-[2-aminoethyl(methyl)amino]-7-nitro-4H-1,4-benzoxazin-3-one (PubChem CID 62687384) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 6-[2-aminoethyl(methyl)amino]-7-nitro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-aminoethyl(methyl)amino]-7-nitro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 62687384 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 6-[2-aminoethyl(methyl)amino]-7-nitro-4H-1,4-benzoxazin-3-one |
| SMILES | CN(CCN)c1cc2c(cc1[N+](=O)[O-])OCC(=O)N2 |
| InChI | InChI=1S/C11H14N4O4/c1-14(3-2-12)8-4-7-10(5-9(8)15(17)18)19-6-11(16)13-7/h4-5H,2-3,6,12H2,1H3,(H,13,16) |
| InChIKey | GHDIHPWOYRVLJE-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|