C11H12N4O5 — CID 43479263
N-methyl-2-[(7-nitro-3-oxo-4H-1,4-benzoxazin-6-yl)amino]acetamide (PubChem CID 43479263) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is N-methyl-2-[(7-nitro-3-oxo-4H-1,4-benzoxazin-6-yl)amino]acetamide.
| Compound Name | N-methyl-2-[(7-nitro-3-oxo-4H-1,4-benzoxazin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 43479263 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | N-methyl-2-[(7-nitro-3-oxo-4H-1,4-benzoxazin-6-yl)amino]acetamide |
| SMILES | CNC(=O)CNc1cc2c(cc1[N+](=O)[O-])OCC(=O)N2 |
| InChI | InChI=1S/C11H12N4O5/c1-12-10(16)4-13-6-2-7-9(3-8(6)15(18)19)20-5-11(17)14-7/h2-3,13H,4-5H2,1H3,(H,12,16)(H,14,17) |
| InChIKey | HSCKQGCSBXCWAO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|