C17H16ClN3O5 — CID 133472921
6-[[2-(2-chlorophenyl)-2-hydroxypropyl]amino]-7-nitro-4H-1,4-benzoxazin-3-one (PubChem CID 133472921) has the molecular formula C17H16ClN3O5 and a molecular weight of 377.78 g/mol. Its IUPAC name is 6-[[2-(2-chlorophenyl)-2-hydroxypropyl]amino]-7-nitro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[[2-(2-chlorophenyl)-2-hydroxypropyl]amino]-7-nitro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 133472921 |
| Molecular Formula | C17H16ClN3O5 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 6-[[2-(2-chlorophenyl)-2-hydroxypropyl]amino]-7-nitro-4H-1,4-benzoxazin-3-one |
| SMILES | CC(O)(CNc1cc2c(cc1[N+](=O)[O-])OCC(=O)N2)c1ccccc1Cl |
| InChI | InChI=1S/C17H16ClN3O5/c1-17(23,10-4-2-3-5-11(10)18)9-19-12-6-13-15(7-14(12)21(24)25)26-8-16(22)20-13/h2-7,19,23H,8-9H2,1H3,(H,20,22) |
| InChIKey | AVSYUCNQTGEHIM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|