C12H12N4O5 — CID 107143768
7-nitro-6-[(5-oxopyrrolidin-3-yl)amino]-4H-1,4-benzoxazin-3-one (PubChem CID 107143768) has the molecular formula C12H12N4O5 and a molecular weight of 292.25 g/mol. Its IUPAC name is 7-nitro-6-[(5-oxopyrrolidin-3-yl)amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-nitro-6-[(5-oxopyrrolidin-3-yl)amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 107143768 |
| Molecular Formula | C12H12N4O5 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 7-nitro-6-[(5-oxopyrrolidin-3-yl)amino]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1CC(Nc2cc3c(cc2[N+](=O)[O-])OCC(=O)N3)CN1 |
| InChI | InChI=1S/C12H12N4O5/c17-11-1-6(4-13-11)14-7-2-8-10(3-9(7)16(19)20)21-5-12(18)15-8/h2-3,6,14H,1,4-5H2,(H,13,17)(H,15,18) |
| InChIKey | ACWHFVCEQIUURG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|