C13H16N4O4 — CID 63252320
6-[(2-aminocyclopentyl)amino]-7-nitro-4H-1,4-benzoxazin-3-one (PubChem CID 63252320) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 6-[(2-aminocyclopentyl)amino]-7-nitro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(2-aminocyclopentyl)amino]-7-nitro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 63252320 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 6-[(2-aminocyclopentyl)amino]-7-nitro-4H-1,4-benzoxazin-3-one |
| SMILES | NC1CCCC1Nc1cc2c(cc1[N+](=O)[O-])OCC(=O)N2 |
| InChI | InChI=1S/C13H16N4O4/c14-7-2-1-3-8(7)15-9-4-10-12(5-11(9)17(19)20)21-6-13(18)16-10/h4-5,7-8,15H,1-3,6,14H2,(H,16,18) |
| InChIKey | ZSEHFJOKVQIREB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|