C13H16N4O2 — CID 82881816
6-N-[(1-methylpyrazol-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine-6,7-diamine (PubChem CID 82881816) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 6-N-[(1-methylpyrazol-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine-6,7-diamine.
| Compound Name | 6-N-[(1-methylpyrazol-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine-6,7-diamine |
|---|---|
| PubChem CID | 82881816 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 6-N-[(1-methylpyrazol-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine-6,7-diamine |
| SMILES | Cn1ccc(CNc2cc3c(cc2N)OCCO3)n1 |
| InChI | InChI=1S/C13H16N4O2/c1-17-3-2-9(16-17)8-15-11-7-13-12(6-10(11)14)18-4-5-19-13/h2-3,6-7,15H,4-5,8,14H2,1H3 |
| InChIKey | LLDCLDFPJCQFHJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|