C10H12IN5 — CID 138522268
5-iodo-3-N-[(1-methylpyrazol-3-yl)methyl]pyridine-2,3-diamine (PubChem CID 138522268) has the molecular formula C10H12IN5 and a molecular weight of 329.15 g/mol. Its IUPAC name is 5-iodo-3-N-[(1-methylpyrazol-3-yl)methyl]pyridine-2,3-diamine.
| Compound Name | 5-iodo-3-N-[(1-methylpyrazol-3-yl)methyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 138522268 |
| Molecular Formula | C10H12IN5 |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 5-iodo-3-N-[(1-methylpyrazol-3-yl)methyl]pyridine-2,3-diamine |
| SMILES | Cn1ccc(CNc2cc(I)cnc2N)n1 |
| InChI | InChI=1S/C10H12IN5/c1-16-3-2-8(15-16)6-13-9-4-7(11)5-14-10(9)12/h2-5,13H,6H2,1H3,(H2,12,14) |
| InChIKey | JHKVJRZMNOSYRI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|