C12H16N4O3 — CID 83005602
7-amino-6-(morpholin-4-ylamino)-4H-1,4-benzoxazin-3-one (PubChem CID 83005602) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 7-amino-6-(morpholin-4-ylamino)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(morpholin-4-ylamino)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 83005602 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 7-amino-6-(morpholin-4-ylamino)-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cc2c(cc1NN1CCOCC1)NC(=O)CO2 |
| InChI | InChI=1S/C12H16N4O3/c13-8-5-11-10(14-12(17)7-19-11)6-9(8)15-16-1-3-18-4-2-16/h5-6,15H,1-4,7,13H2,(H,14,17) |
| InChIKey | NYIAYRSIWGSBDK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|