C11H15NO2 — CID 143712087
ethane;7-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 143712087) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is ethane;7-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | ethane;7-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 143712087 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethane;7-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC.Cc1ccc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C9H9NO2.C2H6/c1-6-2-3-7-8(4-6)12-5-9(11)10-7;1-2/h2-4H,5H2,1H3,(H,10,11);1-2H3 |
| InChIKey | OZOCQQXXDPTWRQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |