C10H11NO2S — CID 116994736
7-(2-sulfanylethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 116994736) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 7-(2-sulfanylethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(2-sulfanylethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116994736 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 7-(2-sulfanylethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(CCS)ccc2N1 |
| InChI | InChI=1S/C10H11NO2S/c12-10-6-13-9-5-7(3-4-14)1-2-8(9)11-10/h1-2,5,14H,3-4,6H2,(H,11,12) |
| InChIKey | BWLWXCFWYBYRBM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|