C9H8ClNO2 — CID 43121482
6-(chloromethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 43121482) has the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. Its IUPAC name is 6-(chloromethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(chloromethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43121482 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 6-(chloromethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(CCl)cc2N1 |
| InChI | InChI=1S/C9H8ClNO2/c10-4-6-1-2-8-7(3-6)11-9(12)5-13-8/h1-3H,4-5H2,(H,11,12) |
| InChIKey | RPPPFOLOXVVXGS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|