C15H12Cl2N2O2 — CID 103075638
6-[(2,6-dichloroanilino)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 103075638) has the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is 6-[(2,6-dichloroanilino)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(2,6-dichloroanilino)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 103075638 |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 6-[(2,6-dichloroanilino)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(CNc3c(Cl)cccc3Cl)cc2N1 |
| InChI | InChI=1S/C15H12Cl2N2O2/c16-10-2-1-3-11(17)15(10)18-7-9-4-5-13-12(6-9)19-14(20)8-21-13/h1-6,18H,7-8H2,(H,19,20) |
| InChIKey | NYYJFYDLCJBOGV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |