C15H13FN2O2 — CID 103075300
6-[(2-fluoroanilino)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 103075300) has the molecular formula C15H13FN2O2 and a molecular weight of 272.28 g/mol. Its IUPAC name is 6-[(2-fluoroanilino)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(2-fluoroanilino)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 103075300 |
| Molecular Formula | C15H13FN2O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 6-[(2-fluoroanilino)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(CNc3ccccc3F)cc2N1 |
| InChI | InChI=1S/C15H13FN2O2/c16-11-3-1-2-4-12(11)17-8-10-5-6-14-13(7-10)18-15(19)9-20-14/h1-7,17H,8-9H2,(H,18,19) |
| InChIKey | SWXKKTAJQPTYGD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |