C10H10ClNO2 — CID 116994731
7-(2-chloroethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 116994731) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 7-(2-chloroethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(2-chloroethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116994731 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 7-(2-chloroethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(CCCl)ccc2N1 |
| InChI | InChI=1S/C10H10ClNO2/c11-4-3-7-1-2-8-9(5-7)14-6-10(13)12-8/h1-2,5H,3-4,6H2,(H,12,13) |
| InChIKey | CXLCPCMWTAOHIR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|