C16H21N3O2 — CID 168924982
7-(2,7-diazaspiro[3.5]nonan-7-ylmethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 168924982) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 7-(2,7-diazaspiro[3.5]nonan-7-ylmethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(2,7-diazaspiro[3.5]nonan-7-ylmethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 168924982 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 7-(2,7-diazaspiro[3.5]nonan-7-ylmethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(CN3CCC4(CC3)CNC4)ccc2N1 |
| InChI | InChI=1S/C16H21N3O2/c20-15-9-21-14-7-12(1-2-13(14)18-15)8-19-5-3-16(4-6-19)10-17-11-16/h1-2,7,17H,3-6,8-11H2,(H,18,20) |
| InChIKey | PSFACTZOSFNTDT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |