C13H19Cl2N3O2 — CID 22326733
6-(piperazin-1-ylmethyl)-4H-1,4-benzoxazin-3-one;dihydrochloride (PubChem CID 22326733) has the molecular formula C13H19Cl2N3O2 and a molecular weight of 320.22 g/mol. Its IUPAC name is 6-(piperazin-1-ylmethyl)-4H-1,4-benzoxazin-3-one;dihydrochloride.
| Compound Name | 6-(piperazin-1-ylmethyl)-4H-1,4-benzoxazin-3-one;dihydrochloride |
|---|---|
| PubChem CID | 22326733 |
| Molecular Formula | C13H19Cl2N3O2 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 6-(piperazin-1-ylmethyl)-4H-1,4-benzoxazin-3-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1COc2ccc(CN3CCNCC3)cc2N1 |
| InChI | InChI=1S/C13H17N3O2.2ClH/c17-13-9-18-12-2-1-10(7-11(12)15-13)8-16-5-3-14-4-6-16;;/h1-2,7,14H,3-6,8-9H2,(H,15,17);2*1H |
| InChIKey | ZNEMNNZXKVSDLA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |