C19H20ClN3O2 — CID 21263905
6-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 21263905) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 6-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 21263905 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 6-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(CN3CCN(c4ccccc4Cl)CC3)cc2N1 |
| InChI | InChI=1S/C19H20ClN3O2/c20-15-3-1-2-4-17(15)23-9-7-22(8-10-23)12-14-5-6-18-16(11-14)21-19(24)13-25-18/h1-6,11H,7-10,12-13H2,(H,21,24) |
| InChIKey | VXIJULJNEBZDDL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |