C20H19ClN2O2 — CID 15431691
7-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]chromen-2-one (PubChem CID 15431691) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 7-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 7-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 15431691 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 7-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]chromen-2-one |
| SMILES | O=c1ccc2ccc(CN3CCN(c4ccccc4Cl)CC3)cc2o1 |
| InChI | InChI=1S/C20H19ClN2O2/c21-17-3-1-2-4-18(17)23-11-9-22(10-12-23)14-15-5-6-16-7-8-20(24)25-19(16)13-15/h1-8,13H,9-12,14H2 |
| InChIKey | QRBCKXQJBNGUAZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|