C27H24ClN3O4 — CID 56860816
4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[(2-chlorophenyl)methyl]isoindole-1,3-dione (PubChem CID 56860816) has the molecular formula C27H24ClN3O4 and a molecular weight of 489.96 g/mol. Its IUPAC name is 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[(2-chlorophenyl)methyl]isoindole-1,3-dione.
| Compound Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[(2-chlorophenyl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 56860816 |
| Molecular Formula | C27H24ClN3O4 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-[(2-chlorophenyl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2cccc(N3CCN(Cc4ccc5c(c4)OCO5)CC3)c2C(=O)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C27H24ClN3O4/c28-21-6-2-1-4-19(21)16-31-26(32)20-5-3-7-22(25(20)27(31)33)30-12-10-29(11-13-30)15-18-8-9-23-24(14-18)35-17-34-23/h1-9,14H,10-13,15-17H2 |
| InChIKey | XYQHCRMEIKHOPJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|