C27H26FN3O3 — CID 42481187
2-[(2-fluorophenyl)methyl]-4-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 42481187) has the molecular formula C27H26FN3O3 and a molecular weight of 459.52 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-4-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2-fluorophenyl)methyl]-4-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42481187 |
| Molecular Formula | C27H26FN3O3 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-4-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1cccc(CN2CCN(c3cccc4c3C(=O)N(Cc3ccccc3F)C4=O)CC2)c1 |
| InChI | InChI=1S/C27H26FN3O3/c1-34-21-8-4-6-19(16-21)17-29-12-14-30(15-13-29)24-11-5-9-22-25(24)27(33)31(26(22)32)18-20-7-2-3-10-23(20)28/h2-11,16H,12-15,17-18H2,1H3 |
| InChIKey | LCZYZNQRQANEKI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|