C24H23FN4O2S — CID 42171695
4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-[(1R)-1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione (PubChem CID 42171695) has the molecular formula C24H23FN4O2S and a molecular weight of 450.54 g/mol. Its IUPAC name is 4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-[(1R)-1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-[(1R)-1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42171695 |
| Molecular Formula | C24H23FN4O2S |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 4-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-2-[(1R)-1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione |
| SMILES | C[C@H](c1nccs1)N1C(=O)c2cccc(N3CCN(Cc4ccccc4F)CC3)c2C1=O |
| InChI | InChI=1S/C24H23FN4O2S/c1-16(22-26-9-14-32-22)29-23(30)18-6-4-8-20(21(18)24(29)31)28-12-10-27(11-13-28)15-17-5-2-3-7-19(17)25/h2-9,14,16H,10-13,15H2,1H3/t16-/m1/s1 |
| InChIKey | QIESPNRSTDRKDG-MRXNPFEDSA-N |
| XLogP | 3.96 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|