C28H29N3O3S — CID 45251308
4-[4-[(2-prop-2-enoxyphenyl)methyl]piperazin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione (PubChem CID 45251308) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is 4-[4-[(2-prop-2-enoxyphenyl)methyl]piperazin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione.
| Compound Name | 4-[4-[(2-prop-2-enoxyphenyl)methyl]piperazin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 45251308 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 4-[4-[(2-prop-2-enoxyphenyl)methyl]piperazin-1-yl]-2-(1-thiophen-2-ylethyl)isoindole-1,3-dione |
| SMILES | C=CCOc1ccccc1CN1CCN(c2cccc3c2C(=O)N(C(C)c2cccs2)C3=O)CC1 |
| InChI | InChI=1S/C28H29N3O3S/c1-3-17-34-24-11-5-4-8-21(24)19-29-13-15-30(16-14-29)23-10-6-9-22-26(23)28(33)31(27(22)32)20(2)25-12-7-18-35-25/h3-12,18,20H,1,13-17,19H2,2H3 |
| InChIKey | DVHVOJUFPPEUFZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|