C22H26N4O2S — CID 75193018
4-[4-(2-methylbut-2-enyl)piperazin-1-yl]-2-[1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione (PubChem CID 75193018) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-[4-(2-methylbut-2-enyl)piperazin-1-yl]-2-[1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 4-[4-(2-methylbut-2-enyl)piperazin-1-yl]-2-[1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 75193018 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 4-[4-(2-methylbut-2-enyl)piperazin-1-yl]-2-[1-(1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione |
| SMILES | CC=C(C)CN1CCN(c2cccc3c2C(=O)N(C(C)c2nccs2)C3=O)CC1 |
| InChI | InChI=1S/C22H26N4O2S/c1-4-15(2)14-24-9-11-25(12-10-24)18-7-5-6-17-19(18)22(28)26(21(17)27)16(3)20-23-8-13-29-20/h4-8,13,16H,9-12,14H2,1-3H3 |
| InChIKey | RJKDTSKGNWOJSD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|