C26H24F3N3O3S — CID 45227870
2-(1-thiophen-2-ylethyl)-4-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 45227870) has the molecular formula C26H24F3N3O3S and a molecular weight of 515.56 g/mol. Its IUPAC name is 2-(1-thiophen-2-ylethyl)-4-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(1-thiophen-2-ylethyl)-4-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45227870 |
| Molecular Formula | C26H24F3N3O3S |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 2-(1-thiophen-2-ylethyl)-4-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | CC(c1cccs1)N1C(=O)c2cccc(N3CCN(Cc4ccc(OC(F)(F)F)cc4)CC3)c2C1=O |
| InChI | InChI=1S/C26H24F3N3O3S/c1-17(22-6-3-15-36-22)32-24(33)20-4-2-5-21(23(20)25(32)34)31-13-11-30(12-14-31)16-18-7-9-19(10-8-18)35-26(27,28)29/h2-10,15,17H,11-14,16H2,1H3 |
| InChIKey | LPMHPHROUUHJRR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|