C23H27N3O4S — CID 125163864
1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-(2-hydroxyethyl)-N-methylpiperidine-4-carboxamide (PubChem CID 125163864) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-(2-hydroxyethyl)-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-(2-hydroxyethyl)-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 125163864 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-[1,3-dioxo-2-[(1S)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-(2-hydroxyethyl)-N-methylpiperidine-4-carboxamide |
| SMILES | C[C@@H](c1cccs1)N1C(=O)c2cccc(N3CCC(C(=O)N(C)CCO)CC3)c2C1=O |
| InChI | InChI=1S/C23H27N3O4S/c1-15(19-7-4-14-31-19)26-22(29)17-5-3-6-18(20(17)23(26)30)25-10-8-16(9-11-25)21(28)24(2)12-13-27/h3-7,14-16,27H,8-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | XGAPNZAODGKPSD-HNNXBMFYSA-N |
| XLogP | 2.77 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|