C27H33N3O3S — CID 125156714
(3R)-N-cyclohexyl-1-[1,3-dioxo-2-[(1R)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide (PubChem CID 125156714) has the molecular formula C27H33N3O3S and a molecular weight of 479.65 g/mol. Its IUPAC name is (3R)-N-cyclohexyl-1-[1,3-dioxo-2-[(1R)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-cyclohexyl-1-[1,3-dioxo-2-[(1R)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 125156714 |
| Molecular Formula | C27H33N3O3S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | (3R)-N-cyclohexyl-1-[1,3-dioxo-2-[(1R)-1-thiophen-2-ylethyl]isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
| SMILES | C[C@H](c1cccs1)N1C(=O)c2cccc(N3CCC[C@@H](C(=O)N(C)C4CCCCC4)C3)c2C1=O |
| InChI | InChI=1S/C27H33N3O3S/c1-18(23-14-8-16-34-23)30-26(32)21-12-6-13-22(24(21)27(30)33)29-15-7-9-19(17-29)25(31)28(2)20-10-4-3-5-11-20/h6,8,12-14,16,18-20H,3-5,7,9-11,15,17H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | JNBRXVMWYGHWFX-RTBURBONSA-N |
| XLogP | 5.11 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|