C25H31N3O3S — CID 45238878
N-butyl-1-[1,3-dioxo-2-(1-thiophen-2-ylethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide (PubChem CID 45238878) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is N-butyl-1-[1,3-dioxo-2-(1-thiophen-2-ylethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide.
| Compound Name | N-butyl-1-[1,3-dioxo-2-(1-thiophen-2-ylethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 45238878 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-butyl-1-[1,3-dioxo-2-(1-thiophen-2-ylethyl)isoindol-4-yl]-N-methylpiperidine-3-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCCN(c2cccc3c2C(=O)N(C(C)c2cccs2)C3=O)C1 |
| InChI | InChI=1S/C25H31N3O3S/c1-4-5-13-26(3)23(29)18-9-7-14-27(16-18)20-11-6-10-19-22(20)25(31)28(24(19)30)17(2)21-12-8-15-32-21/h6,8,10-12,15,17-18H,4-5,7,9,13-14,16H2,1-3H3 |
| InChIKey | FYTTVGVBAPGMIF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|